C22H32N4O2 — CID 136521359
2-(4-methoxy-1H-indol-3-yl)-1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 136521359) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-(4-methoxy-1H-indol-3-yl)-1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-methoxy-1H-indol-3-yl)-1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 136521359 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-(4-methoxy-1H-indol-3-yl)-1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | COc1cccc2[nH]cc(CC(=O)N3CCN(CC4CCCCN4C)CC3)c12 |
| InChI | InChI=1S/C22H32N4O2/c1-24-9-4-3-6-18(24)16-25-10-12-26(13-11-25)21(27)14-17-15-23-19-7-5-8-20(28-2)22(17)19/h5,7-8,15,18,23H,3-4,6,9-14,16H2,1-2H3 |
| InChIKey | QSVMSKVPDHFKGV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |