C15H21N2O4P — CID 169286665
[3-[2-(2,4-dimethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 169286665) has the molecular formula C15H21N2O4P and a molecular weight of 324.32 g/mol. Its IUPAC name is [3-[2-(2,4-dimethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-[2-(2,4-dimethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 169286665 |
| Molecular Formula | C15H21N2O4P |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [3-[2-(2,4-dimethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | CC1CC(C)N1CCc1c[nH]c2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C15H21N2O4P/c1-10-8-11(2)17(10)7-6-12-9-16-13-4-3-5-14(15(12)13)21-22(18,19)20/h3-5,9-11,16H,6-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | LHEXMFRRVRXMCO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|