C17H25N2O4P — CID 169286698
[3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 169286698) has the molecular formula C17H25N2O4P and a molecular weight of 352.37 g/mol. Its IUPAC name is [3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 169286698 |
| Molecular Formula | C17H25N2O4P |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | CCC1CN(CCc2c[nH]c3cccc(OP(=O)(O)O)c23)C1CC |
| InChI | InChI=1S/C17H25N2O4P/c1-3-12-11-19(15(12)4-2)9-8-13-10-18-14-6-5-7-16(17(13)14)23-24(20,21)22/h5-7,10,12,15,18H,3-4,8-9,11H2,1-2H3,(H2,20,21,22) |
| InChIKey | CRNKYEUDFANZKL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|