C17H24N2O — CID 169286708
3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-ol (PubChem CID 169286708) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-ol.
| Compound Name | 3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-ol |
|---|---|
| PubChem CID | 169286708 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-[2-(2,3-diethylazetidin-1-yl)ethyl]-1H-indol-4-ol |
| SMILES | CCC1CN(CCc2c[nH]c3cccc(O)c23)C1CC |
| InChI | InChI=1S/C17H24N2O/c1-3-12-11-19(15(12)4-2)9-8-13-10-18-14-6-5-7-16(20)17(13)14/h5-7,10,12,15,18,20H,3-4,8-9,11H2,1-2H3 |
| InChIKey | RALMTIZKXJKFPS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |