C21H31N2O4P — CID 166727431
(2,4-diethyl-6-methyl-8,18-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),12(17),13,15-tetraen-13-yl) dihydrogen phosphate (PubChem CID 166727431) has the molecular formula C21H31N2O4P and a molecular weight of 406.46 g/mol. Its IUPAC name is (2,4-diethyl-6-methyl-8,18-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),12(17),13,15-tetraen-13-yl) dihydrogen phosphate.
| Compound Name | (2,4-diethyl-6-methyl-8,18-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),12(17),13,15-tetraen-13-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 166727431 |
| Molecular Formula | C21H31N2O4P |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (2,4-diethyl-6-methyl-8,18-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1(11),12(17),13,15-tetraen-13-yl) dihydrogen phosphate |
| SMILES | CCC1CC(C)CN2CCc3c([nH]c4cccc(OP(=O)(O)O)c34)C(CC)C12 |
| InChI | InChI=1S/C21H31N2O4P/c1-4-14-11-13(3)12-23-10-9-16-19-17(22-20(16)15(5-2)21(14)23)7-6-8-18(19)27-28(24,25)26/h6-8,13-15,21-22H,4-5,9-12H2,1-3H3,(H2,24,25,26) |
| InChIKey | NRANAMYSDITOKM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|