C20H29N2O4P — CID 166770619
[3-(2-aminoethyl)-2-(6-ethyl-2-bicyclo[2.2.2]octanyl)-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 166770619) has the molecular formula C20H29N2O4P and a molecular weight of 392.44 g/mol. Its IUPAC name is [3-(2-aminoethyl)-2-(6-ethyl-2-bicyclo[2.2.2]octanyl)-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-(2-aminoethyl)-2-(6-ethyl-2-bicyclo[2.2.2]octanyl)-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 166770619 |
| Molecular Formula | C20H29N2O4P |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [3-(2-aminoethyl)-2-(6-ethyl-2-bicyclo[2.2.2]octanyl)-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | CCC1CC2CCC1C(c1[nH]c3cccc(OP(=O)(O)O)c3c1CCN)C2 |
| InChI | InChI=1S/C20H29N2O4P/c1-2-13-10-12-6-7-14(13)16(11-12)20-15(8-9-21)19-17(22-20)4-3-5-18(19)26-27(23,24)25/h3-5,12-14,16,22H,2,6-11,21H2,1H3,(H2,23,24,25) |
| InChIKey | ACVDJJBDCUHYPN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|