C14H18NO4P — CID 178091436
[8-[2-(dimethylamino)ethyl]naphthalen-1-yl] dihydrogen phosphate (PubChem CID 178091436) has the molecular formula C14H18NO4P and a molecular weight of 295.28 g/mol. Its IUPAC name is [8-[2-(dimethylamino)ethyl]naphthalen-1-yl] dihydrogen phosphate.
| Compound Name | [8-[2-(dimethylamino)ethyl]naphthalen-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 178091436 |
| Molecular Formula | C14H18NO4P |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [8-[2-(dimethylamino)ethyl]naphthalen-1-yl] dihydrogen phosphate |
| SMILES | CN(C)CCc1cccc2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C14H18NO4P/c1-15(2)10-9-12-6-3-5-11-7-4-8-13(14(11)12)19-20(16,17)18/h3-8H,9-10H2,1-2H3,(H2,16,17,18) |
| InChIKey | WUMKWFUOLYVEFL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|