C22H30N3O4P — CID 167375820
[3-[2-(dimethylamino)ethyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 167375820) has the molecular formula C22H30N3O4P and a molecular weight of 431.47 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 167375820 |
| Molecular Formula | C22H30N3O4P |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-2-[1-[4-(dimethylamino)phenyl]ethyl]-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | CC(c1ccc(N(C)C)cc1)c1[nH]c2cccc(OP(=O)(O)O)c2c1CCN(C)C |
| InChI | InChI=1S/C22H30N3O4P/c1-15(16-9-11-17(12-10-16)25(4)5)22-18(13-14-24(2)3)21-19(23-22)7-6-8-20(21)29-30(26,27)28/h6-12,15,23H,13-14H2,1-5H3,(H2,26,27,28) |
| InChIKey | MSQSFJQDDBOKHM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|