C15H19IN2O2 — CID 162478106
[3-[2-(dimethylamino)ethyl]-2-iodo-1H-indol-4-yl] propanoate (PubChem CID 162478106) has the molecular formula C15H19IN2O2 and a molecular weight of 386.23 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-2-iodo-1H-indol-4-yl] propanoate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-2-iodo-1H-indol-4-yl] propanoate |
|---|---|
| PubChem CID | 162478106 |
| Molecular Formula | C15H19IN2O2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-2-iodo-1H-indol-4-yl] propanoate |
| SMILES | CCC(=O)Oc1cccc2[nH]c(I)c(CCN(C)C)c12 |
| InChI | InChI=1S/C15H19IN2O2/c1-4-13(19)20-12-7-5-6-11-14(12)10(15(16)17-11)8-9-18(2)3/h5-7,17H,4,8-9H2,1-3H3 |
| InChIKey | GWYMRGMTYZDCEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|