C13H19N2O4P — CID 162744827
[3-[2-(dimethylamino)ethyl]-7-methyl-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 162744827) has the molecular formula C13H19N2O4P and a molecular weight of 298.28 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethyl]-7-methyl-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-[2-(dimethylamino)ethyl]-7-methyl-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162744827 |
| Molecular Formula | C13H19N2O4P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [3-[2-(dimethylamino)ethyl]-7-methyl-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | Cc1ccc(OP(=O)(O)O)c2c(CCN(C)C)c[nH]c12 |
| InChI | InChI=1S/C13H19N2O4P/c1-9-4-5-11(19-20(16,17)18)12-10(6-7-15(2)3)8-14-13(9)12/h4-5,8,14H,6-7H2,1-3H3,(H2,16,17,18) |
| InChIKey | MVEPADHZIXCGAL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|