C23H30N2O7S — CID 163129964
(1S,2S,3S)-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-3-ethyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-1-sulfonic acid (PubChem CID 163129964) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is (1S,2S,3S)-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-3-ethyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-1-sulfonic acid.
| Compound Name | (1S,2S,3S)-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-3-ethyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-1-sulfonic acid |
|---|---|
| PubChem CID | 163129964 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (1S,2S,3S)-2-[(E)-1,3-dimethoxy-3-oxoprop-1-en-2-yl]-3-ethyl-8-methoxy-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizine-1-sulfonic acid |
| SMILES | CC[C@@H]1CN2CCc3c([nH]c4cccc(OC)c34)C2[C@@H](S(=O)(=O)O)[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H30N2O7S/c1-5-13-11-25-10-9-14-19-16(7-6-8-17(19)31-3)24-20(14)21(25)22(33(27,28)29)18(13)15(12-30-2)23(26)32-4/h6-8,12-13,18,21-22,24H,5,9-11H2,1-4H3,(H,27,28,29)/b15-12+/t13-,18+,21?,22+/m1/s1 |
| InChIKey | FTJBUMSHGPGFQJ-DHEQOXOASA-N |
| XLogP | 2.69 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|