C23H29BN2O4 — CID 154672899
CID 154672899 (PubChem CID 154672899) has the molecular formula C23H29BN2O4 and a molecular weight of 408.31 g/mol.
| Compound Name | CID 154672899 |
|---|---|
| PubChem CID | 154672899 |
| Molecular Formula | C23H29BN2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | — |
| SMILES | [B]C12C[C@H](/C(=C\OC)C(=O)OC)C(CC)CN1CCc1c2[nH]c2cccc(OC)c12 |
| InChI | InChI=1S/C23H29BN2O4/c1-5-14-12-26-10-9-15-20-18(7-6-8-19(20)29-3)25-21(15)23(26,24)11-16(14)17(13-28-2)22(27)30-4/h6-8,13-14,16,25H,5,9-12H2,1-4H3/b17-13+/t14?,16-,23?/m0/s1 |
| InChIKey | LGEBARFNKCDJDJ-VXZXSBGTSA-N |
| XLogP | 3.11 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|