C23H28N2O4 — CID 155043710
methyl (E)-2-[(2R,3S)-3-ethyl-8-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate (PubChem CID 155043710) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl (E)-2-[(2R,3S)-3-ethyl-8-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2R,3S)-3-ethyl-8-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 155043710 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl (E)-2-[(2R,3S)-3-ethyl-8-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
| SMILES | CC[C@@H]1CN2CCc3c([nH]c4cccc(OC)c34)C2=C[C@@H]1/C(=C\OC)C(=O)OC |
| InChI | InChI=1S/C23H28N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,11,13-14,16,24H,5,9-10,12H2,1-4H3/b17-13+/t14-,16+/m1/s1 |
| InChIKey | KKBPPCPELNSATQ-DCHMLSIZSA-N |
| XLogP | 3.73 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|