C23H30N2O3 — CID 164755789
[(2S,3S,12bS)-12b-deuterio-3-ethyl-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-8-yl] acetate (PubChem CID 164755789) has the molecular formula C23H30N2O3 and a molecular weight of 383.51 g/mol. Its IUPAC name is [(2S,3S,12bS)-12b-deuterio-3-ethyl-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-8-yl] acetate.
| Compound Name | [(2S,3S,12bS)-12b-deuterio-3-ethyl-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-8-yl] acetate |
|---|---|
| PubChem CID | 164755789 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | [(2S,3S,12bS)-12b-deuterio-3-ethyl-2-[(Z)-1-methoxyprop-1-en-2-yl]-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-8-yl] acetate |
| SMILES | [2H][C@@]12C[C@H](/C(C)=C\OC)[C@H](CC)CN1CCc1c2[nH]c2cccc(OC(C)=O)c12 |
| InChI | InChI=1S/C23H30N2O3/c1-5-16-12-25-10-9-17-22-19(7-6-8-21(22)28-15(3)26)24-23(17)20(25)11-18(16)14(2)13-27-4/h6-8,13,16,18,20,24H,5,9-12H2,1-4H3/b14-13-/t16-,18-,20+/m1/s1/i20D |
| InChIKey | FAJSMIABQPCGDD-QBVSCVHGSA-N |
| XLogP | 4.59 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|