C21H28N2 — CID 165020189
(2S,3S,12bS)-2-[(Z)-but-2-en-2-yl]-12b-deuterio-3-ethyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizine (PubChem CID 165020189) has the molecular formula C21H28N2 and a molecular weight of 309.48 g/mol. Its IUPAC name is (2S,3S,12bS)-2-[(Z)-but-2-en-2-yl]-12b-deuterio-3-ethyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizine.
| Compound Name | (2S,3S,12bS)-2-[(Z)-but-2-en-2-yl]-12b-deuterio-3-ethyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 165020189 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (2S,3S,12bS)-2-[(Z)-but-2-en-2-yl]-12b-deuterio-3-ethyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizine |
| SMILES | [2H][C@@]12C[C@H](/C(C)=C\C)[C@H](CC)CN1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C21H28N2/c1-4-14(3)18-12-20-21-17(10-11-23(20)13-15(18)5-2)16-8-6-7-9-19(16)22-21/h4,6-9,15,18,20,22H,5,10-13H2,1-3H3/b14-4-/t15-,18-,20+/m1/s1/i20D |
| InChIKey | WVOJTGXXZWUYFB-ONGCDGCSSA-N |
| XLogP | 5.08 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|