C18H24N2O2 — CID 11022980
(1S)-1-[(1S,3S,12bS)-1-(hydroxymethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-3-yl]ethanol (PubChem CID 11022980) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1S)-1-[(1S,3S,12bS)-1-(hydroxymethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-3-yl]ethanol.
| Compound Name | (1S)-1-[(1S,3S,12bS)-1-(hydroxymethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-3-yl]ethanol |
|---|---|
| PubChem CID | 11022980 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (1S)-1-[(1S,3S,12bS)-1-(hydroxymethyl)-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-3-yl]ethanol |
| SMILES | C[C@H](O)[C@H]1C[C@H](CO)[C@H]2c3[nH]c4ccccc4c3CCN2C1 |
| InChI | InChI=1S/C18H24N2O2/c1-11(22)12-8-13(10-21)18-17-15(6-7-20(18)9-12)14-4-2-3-5-16(14)19-17/h2-5,11-13,18-19,21-22H,6-10H2,1H3/t11-,12-,13+,18-/m0/s1 |
| InChIKey | RMYOBRDLCKOPHE-JWXAPSBJSA-N |
| XLogP | 2.08 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|