C21H30N2 — CID 146507207
(15S)-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene (PubChem CID 146507207) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is (15S)-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene.
| Compound Name | (15S)-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 146507207 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (15S)-17-methyl-15-(2-methylbutyl)-3,13-diazatetracyclo[11.3.1.02,10.04,9]heptadeca-2(10),4,6,8-tetraene |
| SMILES | CCC(C)C[C@H]1CC2c3[nH]c4ccccc4c3CCN(C1)C2C |
| InChI | InChI=1S/C21H30N2/c1-4-14(2)11-16-12-19-15(3)23(13-16)10-9-18-17-7-5-6-8-20(17)22-21(18)19/h5-8,14-16,19,22H,4,9-13H2,1-3H3/t14?,15?,16-,19?/m0/s1 |
| InChIKey | ZSORIQUDLIZWTQ-LDWRGQNGSA-N |
| XLogP | 4.95 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |