C21H23N3 — CID 10381147
(2S,3R)-5-methyl-3-phenyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene (PubChem CID 10381147) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-phenyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene.
| Compound Name | (2S,3R)-5-methyl-3-phenyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene |
|---|---|
| PubChem CID | 10381147 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (2S,3R)-5-methyl-3-phenyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraene |
| SMILES | CN1C[C@@H](c2ccccc2)[C@H]2c3[nH]c4ccccc4c3CCN2C1 |
| InChI | InChI=1S/C21H23N3/c1-23-13-18(15-7-3-2-4-8-15)21-20-17(11-12-24(21)14-23)16-9-5-6-10-19(16)22-20/h2-10,18,21-22H,11-14H2,1H3/t18-,21-/m0/s1 |
| InChIKey | GHCPTPIVAPPHOE-RXVVDRJESA-N |
| XLogP | 3.75 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|