C27H26N2 — CID 164666168
(1S,20S,21R)-20-ethyl-21-phenyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,14,16,18-heptaene (PubChem CID 164666168) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (1S,20S,21R)-20-ethyl-21-phenyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,14,16,18-heptaene.
| Compound Name | (1S,20S,21R)-20-ethyl-21-phenyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,14,16,18-heptaene |
|---|---|
| PubChem CID | 164666168 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (1S,20S,21R)-20-ethyl-21-phenyl-3,13-diazapentacyclo[11.8.0.02,10.04,9.014,19]henicosa-2(10),4,6,8,14,16,18-heptaene |
| SMILES | CC[C@@H]1c2ccccc2N2CCc3c([nH]c4ccccc34)[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H26N2/c1-2-19-21-13-7-9-15-24(21)29-17-16-22-20-12-6-8-14-23(20)28-26(22)27(29)25(19)18-10-4-3-5-11-18/h3-15,19,25,27-28H,2,16-17H2,1H3/t19-,25+,27+/m1/s1 |
| InChIKey | XZEXYJSXWGRXKW-KAZGAHJFSA-N |
| XLogP | 6.56 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|