C23H26N2O2 — CID 93153160
methyl (5S,6S)-3-ethyl-6-phenyl-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole-5-carboxylate (PubChem CID 93153160) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is methyl (5S,6S)-3-ethyl-6-phenyl-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole-5-carboxylate.
| Compound Name | methyl (5S,6S)-3-ethyl-6-phenyl-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 93153160 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | methyl (5S,6S)-3-ethyl-6-phenyl-1,2,4,5,6,7-hexahydroazocino[5,4-b]indole-5-carboxylate |
| SMILES | CCN1CCc2c([nH]c3ccccc23)[C@H](c2ccccc2)[C@H](C(=O)OC)C1 |
| InChI | InChI=1S/C23H26N2O2/c1-3-25-14-13-18-17-11-7-8-12-20(17)24-22(18)21(16-9-5-4-6-10-16)19(15-25)23(26)27-2/h4-12,19,21,24H,3,13-15H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | PCWVASSHYFDVBB-TZIWHRDSSA-N |
| XLogP | 3.97 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |