C17H18N2O — CID 135086287
1-ethyl-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizin-4-one (PubChem CID 135086287) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-ethyl-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizin-4-one.
| Compound Name | 1-ethyl-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizin-4-one |
|---|---|
| PubChem CID | 135086287 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-ethyl-6,7,12,12b-tetrahydro-1H-indolo[2,3-a]quinolizin-4-one |
| SMILES | CCC1C=CC(=O)N2CCc3c([nH]c4ccccc34)C12 |
| InChI | InChI=1S/C17H18N2O/c1-2-11-7-8-15(20)19-10-9-13-12-5-3-4-6-14(12)18-16(13)17(11)19/h3-8,11,17-18H,2,9-10H2,1H3 |
| InChIKey | FMWROVDKHVMKNH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|