C19H23N3 — CID 11044585
2-[(1R,3S,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]acetonitrile (PubChem CID 11044585) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[(1R,3S,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]acetonitrile.
| Compound Name | 2-[(1R,3S,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 11044585 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-[(1R,3S,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-1-yl]acetonitrile |
| SMILES | CC[C@H]1C[C@H](CC#N)[C@@H]2c3[nH]c4ccccc4c3CCN2C1 |
| InChI | InChI=1S/C19H23N3/c1-2-13-11-14(7-9-20)19-18-16(8-10-22(19)12-13)15-5-3-4-6-17(15)21-18/h3-6,13-14,19,21H,2,7-8,10-12H2,1H3/t13-,14-,19+/m0/s1 |
| InChIKey | YNGREDQOHXLJLN-CKFHNAJUSA-N |
| XLogP | 4.03 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|