C14H19N2O4P — CID 163393984
[3-[2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-4-yl] dihydrogen phosphate (PubChem CID 163393984) has the molecular formula C14H19N2O4P and a molecular weight of 321.36 g/mol. Its IUPAC name is [3-[2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-4-yl] dihydrogen phosphate.
| Compound Name | [3-[2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 163393984 |
| Molecular Formula | C14H19N2O4P |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | [3-[2,2,3,3,5,5,6,6-octadeuterio-1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-4-yl] dihydrogen phosphate |
| SMILES | [2H]C([2H])([2H])N1C([2H])([2H])C([2H])([2H])C(c2c[nH]c3cccc(OP(=O)(O)O)c23)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C14H19N2O4P/c1-16-7-5-10(6-8-16)11-9-15-12-3-2-4-13(14(11)12)20-21(17,18)19/h2-4,9-10,15H,5-8H2,1H3,(H2,17,18,19)/i1D3,5D2,6D2,7D2,8D2 |
| InChIKey | RCERINIXQUJUKF-NTAJKZOPSA-N |
| XLogP | 2.45 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|