C13H16N2O — CID 163393959
3-(2,2,5,5-tetradeuterio-1-methylpyrrolidin-3-yl)-1H-indol-4-ol (PubChem CID 163393959) has the molecular formula C13H16N2O and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-(2,2,5,5-tetradeuterio-1-methylpyrrolidin-3-yl)-1H-indol-4-ol.
| Compound Name | 3-(2,2,5,5-tetradeuterio-1-methylpyrrolidin-3-yl)-1H-indol-4-ol |
|---|---|
| PubChem CID | 163393959 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-(2,2,5,5-tetradeuterio-1-methylpyrrolidin-3-yl)-1H-indol-4-ol |
| SMILES | [2H]C1([2H])CC(c2c[nH]c3cccc(O)c23)C([2H])([2H])N1C |
| InChI | InChI=1S/C13H16N2O/c1-15-6-5-9(8-15)10-7-14-11-3-2-4-12(16)13(10)11/h2-4,7,9,14,16H,5-6,8H2,1H3/i6D2,8D2 |
| InChIKey | DZKMCQNELDTDGP-GBIJOAKOSA-N |
| XLogP | 2.29 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |