C12H16N2O4P- — CID 168744315
[3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate (PubChem CID 168744315) has the molecular formula C12H16N2O4P- and a molecular weight of 287.27 g/mol. Its IUPAC name is [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate.
| Compound Name | [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 168744315 |
| Molecular Formula | C12H16N2O4P- |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate |
| SMILES | [2H]C([2H])(c1c[nH]c2cccc(OP(=O)([O-])O)c12)C([2H])([2H])N(C)C |
| InChI | InChI=1S/C12H17N2O4P/c1-14(2)7-6-9-8-13-10-4-3-5-11(12(9)10)18-19(15,16)17/h3-5,8,13H,6-7H2,1-2H3,(H2,15,16,17)/p-1/i6D2,7D2 |
| InChIKey | QVDSEJDULKLHCG-KXGHAPEVSA-M |
| XLogP | 1.11 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|