C14H20N2O — CID 71748984
3-[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl]-1H-indol-4-ol (PubChem CID 71748984) has the molecular formula C14H20N2O and a molecular weight of 236.35 g/mol. Its IUPAC name is 3-[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl]-1H-indol-4-ol.
| Compound Name | 3-[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl]-1H-indol-4-ol |
|---|---|
| PubChem CID | 71748984 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 3-[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl]-1H-indol-4-ol |
| SMILES | [2H]C([2H])(c1c[nH]c2cccc(O)c12)C([2H])([2H])N(CC)CC |
| InChI | InChI=1S/C14H20N2O/c1-3-16(4-2)9-8-11-10-15-12-6-5-7-13(17)14(11)12/h5-7,10,15,17H,3-4,8-9H2,1-2H3/i8D2,9D2 |
| InChIKey | OHHYMKDBKJPILO-LZMSFWOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |