C15H22N2O4 — CID 175999379
3-[2-(dimethylamino)ethyl]-1H-indol-4-ol;2-hydroxypropanoic acid (PubChem CID 175999379) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl]-1H-indol-4-ol;2-hydroxypropanoic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl]-1H-indol-4-ol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 175999379 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl]-1H-indol-4-ol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.CN(C)CCc1c[nH]c2cccc(O)c12 |
| InChI | InChI=1S/C12H16N2O.C3H6O3/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10;1-2(4)3(5)6/h3-5,8,13,15H,6-7H2,1-2H3;2,4H,1H3,(H,5,6) |
| InChIKey | KFQIAIMXQAAWDJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |