C16H22N2O — CID 166468740
3-[2-[propan-2-yl(prop-2-enyl)amino]ethyl]-1H-indol-4-ol (PubChem CID 166468740) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[2-[propan-2-yl(prop-2-enyl)amino]ethyl]-1H-indol-4-ol.
| Compound Name | 3-[2-[propan-2-yl(prop-2-enyl)amino]ethyl]-1H-indol-4-ol |
|---|---|
| PubChem CID | 166468740 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-[2-[propan-2-yl(prop-2-enyl)amino]ethyl]-1H-indol-4-ol |
| SMILES | C=CCN(CCc1c[nH]c2cccc(O)c12)C(C)C |
| InChI | InChI=1S/C16H22N2O/c1-4-9-18(12(2)3)10-8-13-11-17-14-6-5-7-15(19)16(13)14/h4-7,11-12,17,19H,1,8-10H2,2-3H3 |
| InChIKey | DBLMZPCKGYMBRR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|