C22H34N2O2 — CID 164541097
1-[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]pent-4-en-2-one;methanol (PubChem CID 164541097) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]pent-4-en-2-one;methanol.
| Compound Name | 1-[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]pent-4-en-2-one;methanol |
|---|---|
| PubChem CID | 164541097 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]pent-4-en-2-one;methanol |
| SMILES | C=CCC(=O)Cc1cccc2[nH]cc(CCN(C(C)C)C(C)C)c12.CO |
| InChI | InChI=1S/C21H30N2O.CH4O/c1-6-8-19(24)13-17-9-7-10-20-21(17)18(14-22-20)11-12-23(15(2)3)16(4)5;1-2/h6-7,9-10,14-16,22H,1,8,11-13H2,2-5H3;2H,1H3 |
| InChIKey | TYUVULSIFSDVID-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|