C20H26N2O4 — CID 162510635
(E)-4-[[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 162510635) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (E)-4-[[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162510635 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (E)-4-[[3-[2-[di(propan-2-yl)amino]ethyl]-1H-indol-4-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)N(CCc1c[nH]c2cccc(OC(=O)/C=C/C(=O)O)c12)C(C)C |
| InChI | InChI=1S/C20H26N2O4/c1-13(2)22(14(3)4)11-10-15-12-21-16-6-5-7-17(20(15)16)26-19(25)9-8-18(23)24/h5-9,12-14,21H,10-11H2,1-4H3,(H,23,24)/b9-8+ |
| InChIKey | FJOSYRRRSVDQBL-CMDGGOBGSA-N |
| XLogP | 3.38 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|