C43H66N4O11 — CID 177308319
bis[2-[2-[2-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] carbonate (PubChem CID 177308319) has the molecular formula C43H66N4O11 and a molecular weight of 815.02 g/mol. Its IUPAC name is bis[2-[2-[2-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] carbonate.
| Compound Name | bis[2-[2-[2-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] carbonate |
|---|---|
| PubChem CID | 177308319 |
| Molecular Formula | C43H66N4O11 |
| Molecular Weight | 815.02 g/mol |
| Exact Mass | 814.47 |
| IUPAC Name | bis[2-[2-[2-[2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl] carbonate |
| SMILES | CN(C)CCc1c[nH]c2cccc(COCCOCCOCCOCCOC(=O)OCCOCCOCCOCCOCc3cccc4[nH]cc(CCN(C)C)c34)c12 |
| InChI | InChI=1S/C43H66N4O11/c1-46(2)13-11-35-31-44-39-9-5-7-37(41(35)39)33-55-25-23-51-17-15-49-19-21-53-27-29-57-43(48)58-30-28-54-22-20-50-16-18-52-24-26-56-34-38-8-6-10-40-42(38)36(32-45-40)12-14-47(3)4/h5-10,31-32,44-45H,11-30,33-34H2,1-4H3 |
| InChIKey | GNKINIGPNQHWOQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.02 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|