C16H22N2O3 — CID 175425600
2-[3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl]ethyl hydrogen carbonate (PubChem CID 175425600) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl]ethyl hydrogen carbonate.
| Compound Name | 2-[3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl]ethyl hydrogen carbonate |
|---|---|
| PubChem CID | 175425600 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[3-[2-[ethyl(methyl)amino]ethyl]-1H-indol-4-yl]ethyl hydrogen carbonate |
| SMILES | CCN(C)CCc1c[nH]c2cccc(CCOC(=O)O)c12 |
| InChI | InChI=1S/C16H22N2O3/c1-3-18(2)9-7-13-11-17-14-6-4-5-12(15(13)14)8-10-21-16(19)20/h4-6,11,17H,3,7-10H2,1-2H3,(H,19,20) |
| InChIKey | BRXNRCBHKRGHOM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |