C17H24N2O4 — CID 176589116
1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl ethyl carbonate (PubChem CID 176589116) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl ethyl carbonate.
| Compound Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl ethyl carbonate |
|---|---|
| PubChem CID | 176589116 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl ethyl carbonate |
| SMILES | CCOC(=O)OC(C)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C17H24N2O4/c1-5-21-17(20)23-12(2)22-15-8-6-7-14-16(15)13(11-18-14)9-10-19(3)4/h6-8,11-12,18H,5,9-10H2,1-4H3 |
| InChIKey | HMJLONCGCKYXQB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|