C18H26N2O4 — CID 176589120
1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl propan-2-yl carbonate (PubChem CID 176589120) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl propan-2-yl carbonate.
| Compound Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176589120 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]ethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OC(C)Oc1cccc2[nH]cc(CCN(C)C)c12 |
| InChI | InChI=1S/C18H26N2O4/c1-12(2)22-18(21)24-13(3)23-16-8-6-7-15-17(16)14(11-19-15)9-10-20(4)5/h6-8,11-13,19H,9-10H2,1-5H3 |
| InChIKey | JDGCBINZBFVAFX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|