C18H25N3O3 — CID 167476975
2-(azetidin-1-yl)ethyl [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] carbonate (PubChem CID 167476975) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-(azetidin-1-yl)ethyl [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] carbonate.
| Compound Name | 2-(azetidin-1-yl)ethyl [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] carbonate |
|---|---|
| PubChem CID | 167476975 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-(azetidin-1-yl)ethyl [3-[2-(dimethylamino)ethyl]-1H-indol-4-yl] carbonate |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC(=O)OCCN3CCC3)c12 |
| InChI | InChI=1S/C18H25N3O3/c1-20(2)10-7-14-13-19-15-5-3-6-16(17(14)15)24-18(22)23-12-11-21-8-4-9-21/h3,5-6,13,19H,4,7-12H2,1-2H3 |
| InChIKey | FFPMZLSRLALALR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|