C18H30N2 — CID 156836181
ethane;N-ethyl-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propan-1-amine (PubChem CID 156836181) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is ethane;N-ethyl-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propan-1-amine.
| Compound Name | ethane;N-ethyl-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 156836181 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | ethane;N-ethyl-N-[2-(4-methyl-1H-indol-3-yl)ethyl]propan-1-amine |
| SMILES | CC.CCCN(CC)CCc1c[nH]c2cccc(C)c12 |
| InChI | InChI=1S/C16H24N2.C2H6/c1-4-10-18(5-2)11-9-14-12-17-15-8-6-7-13(3)16(14)15;1-2/h6-8,12,17H,4-5,9-11H2,1-3H3;1-2H3 |
| InChIKey | XMZYIRKYNHQMCN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |