C22H27FN2O3S — CID 163399467
[3-[2-(dipropylamino)ethyl]-1H-indol-4-yl] 4-fluorobenzenesulfonate (PubChem CID 163399467) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is [3-[2-(dipropylamino)ethyl]-1H-indol-4-yl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[2-(dipropylamino)ethyl]-1H-indol-4-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 163399467 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [3-[2-(dipropylamino)ethyl]-1H-indol-4-yl] 4-fluorobenzenesulfonate |
| SMILES | CCCN(CCC)CCc1c[nH]c2cccc(OS(=O)(=O)c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C22H27FN2O3S/c1-3-13-25(14-4-2)15-12-17-16-24-20-6-5-7-21(22(17)20)28-29(26,27)19-10-8-18(23)9-11-19/h5-11,16,24H,3-4,12-15H2,1-2H3 |
| InChIKey | ODGPIZCYPYZNNP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|