C17H23F3N2O3S — CID 10691904
[3-[2-(dipropylamino)ethyl]-1H-indol-5-yl] trifluoromethanesulfonate (PubChem CID 10691904) has the molecular formula C17H23F3N2O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is [3-[2-(dipropylamino)ethyl]-1H-indol-5-yl] trifluoromethanesulfonate.
| Compound Name | [3-[2-(dipropylamino)ethyl]-1H-indol-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10691904 |
| Molecular Formula | C17H23F3N2O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [3-[2-(dipropylamino)ethyl]-1H-indol-5-yl] trifluoromethanesulfonate |
| SMILES | CCCN(CCC)CCc1c[nH]c2ccc(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C17H23F3N2O3S/c1-3-8-22(9-4-2)10-7-13-12-21-16-6-5-14(11-15(13)16)25-26(23,24)17(18,19)20/h5-6,11-12,21H,3-4,7-10H2,1-2H3 |
| InChIKey | WWJQYDAINIQCOK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|