C19H16F5N2O2+ — CID 176800447
dimethyl-[2-[4-(2,3,4,5,6-pentafluorobenzoyl)oxy-1H-indol-3-yl]ethyl]azanium (PubChem CID 176800447) has the molecular formula C19H16F5N2O2+ and a molecular weight of 399.34 g/mol. Its IUPAC name is dimethyl-[2-[4-(2,3,4,5,6-pentafluorobenzoyl)oxy-1H-indol-3-yl]ethyl]azanium.
| Compound Name | dimethyl-[2-[4-(2,3,4,5,6-pentafluorobenzoyl)oxy-1H-indol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 176800447 |
| Molecular Formula | C19H16F5N2O2+ |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | dimethyl-[2-[4-(2,3,4,5,6-pentafluorobenzoyl)oxy-1H-indol-3-yl]ethyl]azanium |
| SMILES | C[NH+](C)CCc1c[nH]c2cccc(OC(=O)c3c(F)c(F)c(F)c(F)c3F)c12 |
| InChI | InChI=1S/C19H15F5N2O2/c1-26(2)7-6-9-8-25-10-4-3-5-11(12(9)10)28-19(27)13-14(20)16(22)18(24)17(23)15(13)21/h3-5,8,25H,6-7H2,1-2H3/p+1 |
| InChIKey | KMQUPESKJKVWSW-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|