C17H24N3O2+ — CID 169186156
2-[4-[(2S)-2-amino-2-cyclopropylacetyl]oxy-1H-indol-3-yl]ethyl-dimethylazanium (PubChem CID 169186156) has the molecular formula C17H24N3O2+ and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-[4-[(2S)-2-amino-2-cyclopropylacetyl]oxy-1H-indol-3-yl]ethyl-dimethylazanium.
| Compound Name | 2-[4-[(2S)-2-amino-2-cyclopropylacetyl]oxy-1H-indol-3-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 169186156 |
| Molecular Formula | C17H24N3O2+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[4-[(2S)-2-amino-2-cyclopropylacetyl]oxy-1H-indol-3-yl]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCc1c[nH]c2cccc(OC(=O)[C@@H](N)C3CC3)c12 |
| InChI | InChI=1S/C17H23N3O2/c1-20(2)9-8-12-10-19-13-4-3-5-14(15(12)13)22-17(21)16(18)11-6-7-11/h3-5,10-11,16,19H,6-9,18H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | HZECNLUVXDOHNM-INIZCTEOSA-O |
| XLogP | 0.50 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|