C17H24N2O5 — CID 178014980
2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 178014980) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 178014980 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[[3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | CN(C)CCc1c[nH]c2cccc(OC3OCC(O)C(O)C3O)c12 |
| InChI | InChI=1S/C17H24N2O5/c1-19(2)7-6-10-8-18-11-4-3-5-13(14(10)11)24-17-16(22)15(21)12(20)9-23-17/h3-5,8,12,15-18,20-22H,6-7,9H2,1-2H3 |
| InChIKey | YSAPXIPHHKEPAS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |