C8H5BrClNO3S — CID 86698834
5-bromo-6-chloro-1H-indole-3-sulfonic acid (PubChem CID 86698834) has the molecular formula C8H5BrClNO3S and a molecular weight of 310.56 g/mol. Its IUPAC name is 5-bromo-6-chloro-1H-indole-3-sulfonic acid.
| Compound Name | 5-bromo-6-chloro-1H-indole-3-sulfonic acid |
|---|---|
| PubChem CID | 86698834 |
| Molecular Formula | C8H5BrClNO3S |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 308.89 |
| IUPAC Name | 5-bromo-6-chloro-1H-indole-3-sulfonic acid |
| SMILES | O=S(=O)(O)c1c[nH]c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C8H5BrClNO3S/c9-5-1-4-7(2-6(5)10)11-3-8(4)15(12,13)14/h1-3,11H,(H,12,13,14) |
| InChIKey | RWMOIMOYUORNOH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|