C17H11BrClFN4O3S — CID 135201608
2-[6-[C-[(5-bromo-6-chloro-1H-indol-3-yl)sulfonyl]carbonimidoyl]-5-fluoro-2-methoxy-3-pyridinyl]acetonitrile (PubChem CID 135201608) has the molecular formula C17H11BrClFN4O3S and a molecular weight of 485.72 g/mol. Its IUPAC name is 2-[6-[C-[(5-bromo-6-chloro-1H-indol-3-yl)sulfonyl]carbonimidoyl]-5-fluoro-2-methoxy-3-pyridinyl]acetonitrile.
| Compound Name | 2-[6-[C-[(5-bromo-6-chloro-1H-indol-3-yl)sulfonyl]carbonimidoyl]-5-fluoro-2-methoxy-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 135201608 |
| Molecular Formula | C17H11BrClFN4O3S |
| Molecular Weight | 485.72 g/mol |
| Exact Mass | 483.94 |
| IUPAC Name | 2-[6-[C-[(5-bromo-6-chloro-1H-indol-3-yl)sulfonyl]carbonimidoyl]-5-fluoro-2-methoxy-3-pyridinyl]acetonitrile |
| SMILES | [H]/N=C(\c1nc(OC)c(CC#N)cc1F)S(=O)(=O)c1c[nH]c2cc(Cl)c(Br)cc12 |
| InChI | InChI=1S/C17H11BrClFN4O3S/c1-27-17-8(2-3-21)4-12(20)15(24-17)16(22)28(25,26)14-7-23-13-6-11(19)10(18)5-9(13)14/h4-7,22-23H,2H2,1H3/b22-16+ |
| InChIKey | PNDPFLVPOFEKEW-CJLVFECKSA-N |
| XLogP | 3.99 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|