C16H12ClF2NO3S — CID 161138082
3-[(4-chloro-2,5-difluorophenyl)methylsulfonyl]-6-methoxy-1H-indole (PubChem CID 161138082) has the molecular formula C16H12ClF2NO3S and a molecular weight of 371.79 g/mol. Its IUPAC name is 3-[(4-chloro-2,5-difluorophenyl)methylsulfonyl]-6-methoxy-1H-indole.
| Compound Name | 3-[(4-chloro-2,5-difluorophenyl)methylsulfonyl]-6-methoxy-1H-indole |
|---|---|
| PubChem CID | 161138082 |
| Molecular Formula | C16H12ClF2NO3S |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 3-[(4-chloro-2,5-difluorophenyl)methylsulfonyl]-6-methoxy-1H-indole |
| SMILES | COc1ccc2c(S(=O)(=O)Cc3cc(F)c(Cl)cc3F)c[nH]c2c1 |
| InChI | InChI=1S/C16H12ClF2NO3S/c1-23-10-2-3-11-15(5-10)20-7-16(11)24(21,22)8-9-4-14(19)12(17)6-13(9)18/h2-7,20H,8H2,1H3 |
| InChIKey | UNBHXTLLEOGFKN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|