C17H13FN2O3S — CID 135187062
N-(4-ethynyl-2-fluorophenyl)-6-methoxy-1H-indole-3-sulfonamide (PubChem CID 135187062) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(4-ethynyl-2-fluorophenyl)-6-methoxy-1H-indole-3-sulfonamide.
| Compound Name | N-(4-ethynyl-2-fluorophenyl)-6-methoxy-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135187062 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-(4-ethynyl-2-fluorophenyl)-6-methoxy-1H-indole-3-sulfonamide |
| SMILES | C#Cc1ccc(NS(=O)(=O)c2c[nH]c3cc(OC)ccc23)c(F)c1 |
| InChI | InChI=1S/C17H13FN2O3S/c1-3-11-4-7-15(14(18)8-11)20-24(21,22)17-10-19-16-9-12(23-2)5-6-13(16)17/h1,4-10,19-20H,2H3 |
| InChIKey | CKHMMAHOCHUQQH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|