C17H14N2O4S2 — CID 135188134
N-(4-ethynylphenyl)-6-methylsulfonyl-1H-indole-3-sulfonamide (PubChem CID 135188134) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-(4-ethynylphenyl)-6-methylsulfonyl-1H-indole-3-sulfonamide.
| Compound Name | N-(4-ethynylphenyl)-6-methylsulfonyl-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135188134 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-(4-ethynylphenyl)-6-methylsulfonyl-1H-indole-3-sulfonamide |
| SMILES | C#Cc1ccc(NS(=O)(=O)c2c[nH]c3cc(S(C)(=O)=O)ccc23)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-3-12-4-6-13(7-5-12)19-25(22,23)17-11-18-16-10-14(24(2,20)21)8-9-15(16)17/h1,4-11,18-19H,2H3 |
| InChIKey | UXGOSWZKLUTXRJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|