C13H13ClN4O2S — CID 176710664
6-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide (PubChem CID 176710664) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is 6-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 176710664 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 6-chloro-N-(4,5-dimethyl-1H-pyrazol-3-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1[nH]nc(NS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)c1C |
| InChI | InChI=1S/C13H13ClN4O2S/c1-7-8(2)16-17-13(7)18-21(19,20)12-6-15-11-5-9(14)3-4-10(11)12/h3-6,15H,1-2H3,(H2,16,17,18) |
| InChIKey | QAVVKOURIDAPEC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |