C15H10ClF2N3O2S — CID 135201227
6-chloro-N-(5-ethenyl-3,6-difluoro-2-pyridinyl)-1H-indole-3-sulfonamide (PubChem CID 135201227) has the molecular formula C15H10ClF2N3O2S and a molecular weight of 369.78 g/mol. Its IUPAC name is 6-chloro-N-(5-ethenyl-3,6-difluoro-2-pyridinyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-(5-ethenyl-3,6-difluoro-2-pyridinyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135201227 |
| Molecular Formula | C15H10ClF2N3O2S |
| Molecular Weight | 369.78 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 6-chloro-N-(5-ethenyl-3,6-difluoro-2-pyridinyl)-1H-indole-3-sulfonamide |
| SMILES | C=Cc1cc(F)c(NS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)nc1F |
| InChI | InChI=1S/C15H10ClF2N3O2S/c1-2-8-5-11(17)15(20-14(8)18)21-24(22,23)13-7-19-12-6-9(16)3-4-10(12)13/h2-7,19H,1H2,(H,20,21) |
| InChIKey | VOBLKSYIMKQKNI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|