C14H8BrClF2N2O2S — CID 135201048
N-(4-bromo-2,5-difluorophenyl)-6-chloro-1H-indole-3-sulfonamide (PubChem CID 135201048) has the molecular formula C14H8BrClF2N2O2S and a molecular weight of 421.65 g/mol. Its IUPAC name is N-(4-bromo-2,5-difluorophenyl)-6-chloro-1H-indole-3-sulfonamide.
| Compound Name | N-(4-bromo-2,5-difluorophenyl)-6-chloro-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135201048 |
| Molecular Formula | C14H8BrClF2N2O2S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | N-(4-bromo-2,5-difluorophenyl)-6-chloro-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(Br)cc1F)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H8BrClF2N2O2S/c15-9-4-11(18)13(5-10(9)17)20-23(21,22)14-6-19-12-3-7(16)1-2-8(12)14/h1-6,19-20H |
| InChIKey | XXRSTRKHKBFLRU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|