C13H11ClN2O2S2 — CID 176711099
6-chloro-N-(4-methylthiophen-3-yl)-1H-indole-3-sulfonamide (PubChem CID 176711099) has the molecular formula C13H11ClN2O2S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 6-chloro-N-(4-methylthiophen-3-yl)-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-(4-methylthiophen-3-yl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 176711099 |
| Molecular Formula | C13H11ClN2O2S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 6-chloro-N-(4-methylthiophen-3-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1cscc1NS(=O)(=O)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H11ClN2O2S2/c1-8-6-19-7-12(8)16-20(17,18)13-5-15-11-4-9(14)2-3-10(11)13/h2-7,15-16H,1H3 |
| InChIKey | DFMJTALGQDYAHS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |